AF30221
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥95% (mixture of epimers) | in stock | $43.00 | $30.00 | - + | |
5mg | 95% | in stock | $80.00 | $56.00 | - + | |
10mg | 95% | in stock | $154.00 | $108.00 | - + | |
25mg | ≥95% (mixture of epimers) | in stock | $245.00 | $171.00 | - + | |
100mg | 95% | in stock | $263.00 | $184.00 | - + | |
250mg | 95% | in stock | $375.00 | $262.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF30221 |
Chemical Name: | Gambogic acid |
CAS Number: | 2752-65-0 |
Molecular Formula: | C38H44O8 |
Molecular Weight: | 628.7512 |
MDL Number: | MFCD16878985 |
SMILES: | CC(=CCc1c2O[C@]34[C@@]5(C/C=C(\C(=O)O)/C)OC([C@@H]4C[C@H](C5=O)C=C3C(=O)c2c(c2c1O[C@](C)(CCC=C(C)C)C=C2)O)(C)C)C |