AI46373
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 70% | in stock | $8.00 | $5.00 | - + | |
1g | 70% | in stock | $11.00 | $8.00 | - + | |
5g | 70% | in stock | $33.00 | $24.00 | - + | |
25g | 70% | in stock | $47.00 | $33.00 | - + | |
100g | 70% | in stock | $139.00 | $97.00 | - + | |
500g | 70% | in stock | $277.00 | $194.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI46373 |
Chemical Name: | 2,4-Dichloro-6,7-dimethoxyquinazoline |
CAS Number: | 27631-29-4 |
Molecular Formula: | C10H8Cl2N2O2 |
Molecular Weight: | 259.0887 |
MDL Number: | MFCD00051733 |
SMILES: | COc1cc2nc(Cl)nc(c2cc1OC)Cl |
Complexity: | 245 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.4 |
Journal of combinatorial chemistry 20010101