AB32593
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $19.00 | $13.00 | - + | |
10g | 97% | in stock | $30.00 | $21.00 | - + | |
25g | 97% | in stock | $66.00 | $47.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB32593 |
Chemical Name: | Boc-tranexamic acid |
CAS Number: | 27687-14-5 |
Molecular Formula: | C13H23NO4 |
Molecular Weight: | 257.326 |
MDL Number: | MFCD00673773 |
SMILES: | O=C(OC(C)(C)C)NC[C@@H]1CC[C@H](CC1)C(=O)O |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.9 |
The trans-4-(((tert-Butoxycarbonyl)amino)methyl)cyclohexanecarboxylic acid is a versatile compound commonly used in chemical synthesis as a protecting group for amino acids. This compound plays a crucial role in peptide synthesis by selectively blocking the amino group of amino acids, thus preventing unwanted reactions while allowing desired reactions to occur. Additionally, it aids in the control of regioselectivity and stereochemistry in complex molecule assembly. Its compatibility with a wide range of reaction conditions and its ease of removal make it a valuable tool for organic chemists striving to achieve precise and efficient synthesis of peptides and peptidomimetics.