AB54001
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $19.00 | $13.00 | - + | |
100g | 98% | in stock | $53.00 | $37.00 | - + | |
500g | 98% | in stock | $182.00 | $127.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54001 |
Chemical Name: | 1,1,1-Tris(4-hydroxyphenyl)ethane |
CAS Number: | 27955-94-8 |
Molecular Formula: | C20H18O3 |
Molecular Weight: | 306.35512 |
MDL Number: | MFCD00012180 |
SMILES: | CC(c1ccc(cc1)O)(c1ccc(cc1)O)c1ccc(cc1)O |
Complexity: | 304 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.1 |
Journal of medicinal chemistry 20090514
Acta crystallographica. Section C, Crystal structure communications 20020401
Acta crystallographica. Section C, Crystal structure communications 20020101
Journal of the American Chemical Society 20010627