AB79396
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $14.00 | $10.00 | - + | |
10g | 97% | in stock | $25.00 | $18.00 | - + | |
25g | 97% | in stock | $60.00 | $42.00 | - + | |
100g | 97% | in stock | $159.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79396 |
Chemical Name: | H-Pro-OtBu |
CAS Number: | 2812-46-6 |
Molecular Formula: | C9H17NO2 |
Molecular Weight: | 171.23678000000004 |
MDL Number: | MFCD00037879 |
SMILES: | O=C([C@@H]1CCCN1)OC(C)(C)C |
Complexity: | 172 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.1 |
Journal of the American Chemical Society 20020626