BJ68718
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | 1 week | $212.00 | $148.00 | - + | |
100mg | 99% | 1 week | $222.00 | $155.00 | - + | |
250mg | 99% | 1 week | $330.00 | $231.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BJ68718 |
Chemical Name: | LSKL, INhibitor of Thrombospondin (TSP-1) trifluoroacetate |
CAS Number: | 2828433-17-4 |
Molecular Formula: | C23H43F3N6O7 |
Molecular Weight: | 572.6187 |
MDL Number: | MFCD01355072 |
SMILES: | OC(=O)C(F)(F)F.NCCCC[C@@H](C(=O)N[C@H](C(=O)N)CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)N)CO |