AB34154
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $49.00 | $34.00 | - + | |
5g | 95% | in stock | $106.00 | $74.00 | - + | |
10g | 95% | in stock | $180.00 | $126.00 | - + | |
25g | 95% | in stock | $333.00 | $233.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB34154 |
Chemical Name: | 4-Benzenesulfonylaminobenzoic acid |
CAS Number: | 28547-16-2 |
Molecular Formula: | C13H11NO4S |
Molecular Weight: | 277.2957 |
MDL Number: | MFCD00531525 |
SMILES: | OC(=O)c1ccc(cc1)NS(=O)(=O)c1ccccc1 |
Complexity: | 401 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.8 |
Acta crystallographica. Section E, Structure reports online 20091201
Journal of medicinal chemistry 20090528
Journal of medicinal chemistry 19971205