AB35855
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $39.00 | $27.00 | - + | |
5g | 97% | in stock | $140.00 | $98.00 | - + | |
10g | 97% | in stock | $267.00 | $187.00 | - + | |
25g | 97% | in stock | $584.00 | $409.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB35855 |
Chemical Name: | 7-Chloro-1H-indole-2-carboxylic acid |
CAS Number: | 28899-75-4 |
Molecular Formula: | C9H6ClNO2 |
Molecular Weight: | 195.6024 |
MDL Number: | MFCD02664428 |
SMILES: | OC(=O)c1cc2c([nH]1)c(Cl)ccc2 |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.9 |
Journal of medicinal chemistry 20040506