AB36440
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $22.00 | $15.00 | - + | |
25g | 95% | in stock | $50.00 | $35.00 | - + | |
100g | 95% | in stock | $119.00 | $84.00 | - + | |
500g | 95% | in stock | $465.00 | $325.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB36440 |
Chemical Name: | N-(2-Oxoethyl)phthalimide |
CAS Number: | 2913-97-5 |
Molecular Formula: | C10H7NO3 |
Molecular Weight: | 189.1675 |
MDL Number: | MFCD00023080 |
SMILES: | O=CCN1C(=O)c2c(C1=O)cccc2 |
NSC Number: | 30242 |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.8 |
The Journal of pharmacy and pharmacology 20010301