AB37560
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $9.00 | - + | |
250mg | 98% | in stock | $26.00 | $18.00 | - + | |
1g | 98% | in stock | $82.00 | $57.00 | - + | |
2g | 98% | in stock | $163.00 | $114.00 | - + | |
10g | 98% | in stock | $579.00 | $405.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB37560 |
Chemical Name: | Dimethyl 1,4-cubanedicarboxylate |
CAS Number: | 29412-62-2 |
Molecular Formula: | C12H12O4 |
Molecular Weight: | 220.2213 |
MDL Number: | MFCD29060101 |
SMILES: | COC(=O)C12C3C4C2C2C1C3C42C(=O)OC |
NSC Number: | 124104 |
Complexity: | 382 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
The Journal of organic chemistry 20050708