logo
Home  > 1,1-Dimethylethyl 20-amino-3,6,9,12,15,18-hexaoxaeicosanoate

AZ94013

297162-50-6 | 1,1-Dimethylethyl 20-amino-3,6,9,12,15,18-hexaoxaeicosanoate

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $18.00 $13.00 -   +
5mg 95% in stock $22.00 $15.00 -   +
10mg 95% in stock $27.00 $19.00 -   +
100mg 95% in stock $33.00 $23.00 -   +
250mg 95% in stock $53.00 $37.00 -   +
1g 95% in stock $140.00 $98.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AZ94013
Chemical Name: 1,1-Dimethylethyl 20-amino-3,6,9,12,15,18-hexaoxaeicosanoate
CAS Number: 297162-50-6
Molecular Formula: C18H37NO8
Molecular Weight: 395.4882799999999
MDL Number: MFCD31656899
SMILES: NCCOCCOCCOCCOCCOCCOCC(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • 1,1-Dimethylethyl 20-amino-3,6,9,12,15,18-hexaoxaeicosanoate is a versatile compound widely used in chemical synthesis due to its unique properties. In chemical synthesis, this compound serves as a crucial building block for the creation of complex molecules. Its specific structure allows for precise positioning within a molecule, enabling the creation of intricate chemical structures. By incorporating 1,1-Dimethylethyl 20-amino-3,6,9,12,15,18-hexaoxaeicosanoate into a synthesis pathway, chemists can efficiently achieve desired chemical transformations and produce novel compounds with tailored properties. This compound plays a key role in the synthesis of pharmaceuticals, agrochemicals, and materials science applications, demonstrating its widespread utility in various fields of chemistry.
FEATURED PRODUCTS