AB52320
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | >98.0%(T)(HPLC) | in stock | $29.00 | $21.00 | - + | |
250mg | 95% | in stock | $43.00 | $30.00 | - + | |
500mg | 95% | in stock | $72.00 | $50.00 | - + | |
1g | ≥ 98% (HPLC) | in stock | $98.00 | $68.00 | - + | |
5g | ≥97% | in stock | $125.00 | $87.00 | - + | |
10g | ≥97% | in stock | $215.00 | $150.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52320 |
Chemical Name: | Nitro Blue Tetrazolium Chloride |
CAS Number: | 298-83-9 |
Molecular Formula: | C40H30Cl2N10O6 |
Molecular Weight: | 817.6356 |
MDL Number: | MFCD00150013 |
SMILES: | COc1cc(ccc1[n+]1nc(nn1c1ccc(cc1)[N+](=O)[O-])c1ccccc1)c1ccc(c(c1)OC)[n+]1nc(nn1c1ccc(cc1)[N+](=O)[O-])c1ccccc1.[Cl-].[Cl-] |
The compound 2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3-(4-nitrophenyl)-5-phenyl-, chloride (1:2) is a versatile reagent commonly used in chemical synthesis processes. Its unique structure allows for the introduction of functional groups, such as nitro and phenyl groups, into a variety of organic molecules. This compound is particularly useful in the development of new pharmaceuticals, agrochemicals, and materials due to its ability to facilitate complex molecular transformations. In addition, its chloride form enhances its solubility and reactivity, making it a valuable tool in research and industrial applications.