AB79293
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥98% | in stock | $80.00 | $56.00 | - + | |
10mg | ≥98% | in stock | $148.00 | $104.00 | - + | |
25mg | >98.0%(HPLC) | in stock | $188.00 | $132.00 | - + | |
50mg | ≥99% | in stock | $366.00 | $257.00 | - + | |
100mg | ≥99% | in stock | $620.00 | $434.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79293 |
Chemical Name: | 2-(3,4-Dimethoxyphenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
CAS Number: | 301305-73-7 |
Molecular Formula: | C18H20N2O4S |
Molecular Weight: | 360.4274 |
MDL Number: | MFCD00617269 |
SMILES: | COc1cc(ccc1OC)C(=O)Nc1sc2c(c1C(=O)N)CCCC2 |
Complexity: | 504 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.4 |
The Biochemical journal 20130415
Nature biotechnology 20111101
Journal of medicinal chemistry 20100225
Bioorganic & medicinal chemistry letters 20060615