AB51671
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 97% | in stock | $6.00 | $4.00 | - + | |
100mg | 97% | in stock | $8.00 | $5.00 | - + | |
1g | 97% | in stock | $13.00 | $9.00 | - + | |
5g | 97% | in stock | $29.00 | $20.00 | - + | |
10g | 97% | in stock | $45.00 | $32.00 | - + | |
25g | 97% | in stock | $90.00 | $63.00 | - + | |
250g | 97% | in stock | $876.00 | $613.00 | - + | |
1kg | 97% | in stock | $3,240.00 | $2,268.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51671 |
Chemical Name: | Coenzyme q10 |
CAS Number: | 303-98-0 |
Molecular Formula: | C59H90O4 |
Molecular Weight: | 863.3435 |
MDL Number: | MFCD00042919 |
SMILES: | COC1=C(OC)C(=O)C(=C(C1=O)C/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)\C)\C)\C)\C)\C)\C)C |
In chemical synthesis, 2,5-Cyclohexadiene-1,4-dione, 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaen-1-yl]-5,6-dimethoxy-3-methyl- plays a crucial role as a versatile building block for the synthesis of complex organic molecules. It serves as a key intermediate in the formation of various compounds with a wide range of potential applications, including pharmaceuticals, agrochemicals, and materials science. Its unique molecular structure enables it to participate in diverse chemical reactions, making it a valuable tool in the development of novel organic compounds with tailored properties and functionalities.