AB40614
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $20.00 | $14.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB40614 |
Chemical Name: | 2,2-Diphenylglycine |
CAS Number: | 3060-50-2 |
Molecular Formula: | C14H13NO2 |
Molecular Weight: | 227.2585 |
MDL Number: | MFCD00008048 |
SMILES: | OC(=O)C(c1ccccc1)(c1ccccc1)N |
NSC Number: | 33392 |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1 |
2,2-Diphenylglycine is a versatile compound that finds broad application in chemical synthesis. As a chiral auxiliary, it can assist in the asymmetric synthesis of various organic molecules, enabling the production of enantiomerically pure compounds. Additionally, 2,2-Diphenylglycine serves as a valuable building block in the preparation of pharmaceuticals, agrochemicals, and advanced materials. Its unique structural properties make it an essential reagent in the development of new synthetic methodologies and the creation of complex molecular structures. By incorporating 2,2-Diphenylglycine into synthetic routes, chemists can access a diverse array of functionalized compounds with high stereoselectivity and efficiency.
The Journal of organic chemistry 20070316