AB41506
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $32.00 | $22.00 | - + | |
250mg | 95% | in stock | $43.00 | $30.00 | - + | |
1g | 95% | in stock | $170.00 | $119.00 | - + | |
5g | 95% | in stock | $666.00 | $466.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB41506 |
Chemical Name: | L-Adenosine |
CAS Number: | 3080-29-3 |
Molecular Formula: | C10H13N5O4 |
Molecular Weight: | 267.2413 |
MDL Number: | MFCD01075784 |
SMILES: | OC[C@@H]1O[C@@H]([C@H]([C@H]1O)O)n1cnc2c1ncnc2N |
Complexity: | 335 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -1.1 |
Antimicrobial agents and chemotherapy 20010101