AB55787
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $8.00 | $5.00 | - + | |
1g | 98% | in stock | $12.00 | $9.00 | - + | |
5g | 98% | in stock | $23.00 | $17.00 | - + | |
10g | 98% | in stock | $42.00 | $30.00 | - + | |
25g | 98% | in stock | $83.00 | $59.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55787 |
Chemical Name: | (S)-(-)-1-(2-Naphthyl)ethylamine |
CAS Number: | 3082-62-0 |
Molecular Formula: | C12H13N |
Molecular Weight: | 171.2383 |
MDL Number: | MFCD00085366 |
SMILES: | C[C@@H](c1ccc2c(c1)cccc2)N |
Complexity: | 167 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.8 |
(S)-(-)-1-(Naphthalen-2-yl)ethylamine, also known as "name", is a versatile compound commonly utilized in chemical synthesis. It serves as a chiral building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Due to its enantiopure nature, (S)-(-)-1-(Naphthalen-2-yl)ethylamine is particularly valuable in asymmetric synthesis, where the stereochemistry of the molecule is crucial in determining the properties and activities of the final product. Its unique structure and reactivity make it a key component in the production of complex organic molecules with high levels of selectivity and efficiency. In the field of drug development, this compound plays a vital role in the synthesis of biologically active compounds, offering new opportunities for the creation of novel therapeutic agents. With its wide range of applications in chemical synthesis, (S)-(-)-1-(Naphthalen-2-yl)ethylamine continues to be a fundamental building block for the advancement of modern organic chemistry.
Magnetic resonance in chemistry : MRC 20090701