AB41918
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $15.00 | $10.00 | - + | |
10g | 98% | in stock | $23.00 | $16.00 | - + | |
25g | 98% | in stock | $45.00 | $31.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB41918 |
Chemical Name: | Boc-Glu-OBzl |
CAS Number: | 30924-93-7 |
Molecular Formula: | C17H23NO6 |
Molecular Weight: | 337.3676 |
MDL Number: | MFCD00065568 |
SMILES: | OC(=O)CC[C@@H](C(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
Complexity: | 437 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 10 |
XLogP3: | 2.2 |
N-tert-Butoxycarbonyl-L-glutamic acid benzyl ester, also known as Boc-Glu(OBzl)-OH, is a valuable compound widely used in chemical synthesis. As a protected form of glutamic acid, this compound plays a crucial role in peptide synthesis and drug development. With its tert-butoxycarbonyl (Boc) protecting group and benzyl ester, N-tert-Butoxycarbonyl-L-glutamic acid benzyl ester offers strategic versatility in building complex peptide structures. Its stability and compatibility with various chemical reactions make it an essential building block for designing novel peptides and peptidomimetics with targeted biological activities. In addition, the selective deprotection of the Boc group allows for further functionalization, enabling tailored modifications to achieve desired molecular properties. This compound is a valuable tool for chemists seeking to advance their research in the fields of medicinal chemistry, biochemistry, and pharmaceuticals.
Bioorganic & medicinal chemistry letters 20100715
Journal of biochemical and biophysical methods 19850501