AF36929
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $249.00 | $175.00 | - + | |
1g | 98% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF36929 |
Chemical Name: | 4-Nitro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
CAS Number: | 312-51-6 |
Molecular Formula: | C13H9F3N2O4S |
Molecular Weight: | 346.2818 |
MDL Number: | MFCD00557265 |
SMILES: | [O-][N+](=O)c1ccc(cc1)S(=O)(=O)Nc1ccc(cc1)C(F)(F)F |
Complexity: | 511 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.7 |
Bioorganic & medicinal chemistry 20080601
Bioorganic & medicinal chemistry 20070115
Bioscience, biotechnology, and biochemistry 20021201