logo
Home  > (1S)-(+)-10-Camphorsulfonic acid

AB54471

3144-16-9 | (1S)-(+)-10-Camphorsulfonic acid

Packsize Purity Availability Price Discounted Price    Quantity
5g 99% in stock $8.00 $5.00 -   +
25g 99% in stock $15.00 $10.00 -   +
100g 99% in stock $36.00 $25.00 -   +
500g 99% in stock $172.00 $120.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB54471
Chemical Name: (1S)-(+)-10-Camphorsulfonic acid
CAS Number: 3144-16-9
Molecular Formula: C10H16O4S
Molecular Weight: 232.2966
MDL Number: MFCD00150752
SMILES: O=C1C[C@@H]2C([C@]1(CC2)CS(=O)(=O)O)(C)C
NSC Number: 4167

 

Computed Properties
Complexity: 404  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  
XLogP3: 0.5  

 

 

Upstream Synthesis Route 
  • The (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. Due to its unique structure and functional groups, $name$ plays a crucial role as a chiral building block in the asymmetric synthesis of organic molecules.In chemical synthesis, (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid serves as a valuable reagent for the preparation of complex molecules with high enantiomeric purity. Its chirality allows for selective bonding and reaction pathways, enabling chemists to control the stereochemistry of the final products.$name$ is particularly favored in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals where chirality plays a vital role in determining biological activity and effectiveness. Its use in asymmetric catalysis and stereoselective transformations has led to the development of efficient routes for the synthesis of advanced intermediates and bioactive compounds.Overall, $name$ is an indispensable tool in modern chemical synthesis, facilitating the creation of diverse molecules with specific stereochemical configurations essential for various applications in drug discovery, materials science, and chemical research.
Literature
FEATURED PRODUCTS