AF56446
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $6.00 | $4.00 | - + | |
25g | 98% | in stock | $7.00 | $5.00 | - + | |
100g | 98% | in stock | $24.00 | $17.00 | - + | |
500g | 98% | in stock | $112.00 | $79.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF56446 |
Chemical Name: | Vanadyl acetylacetonate |
CAS Number: | 3153-26-2 |
Molecular Formula: | C10H14O4V |
Molecular Weight: | 249.1573 |
MDL Number: | MFCD00000032 |
SMILES: | CC1=CC(=[O+][V-2]2(O1)OC(=CC(=[O+]2)C)C)C |
Complexity: | 253 |
Covalently-Bonded Unit Count: | 3 |
Defined Bond Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
The Journal of biological chemistry 20020405