AF82544
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $9.00 | $6.00 | - + | |
5mg | 95% | in stock | $20.00 | $14.00 | - + | |
10mg | 95% | in stock | $30.00 | $21.00 | - + | |
25mg | 95% | in stock | $48.00 | $34.00 | - + | |
50mg | 95% | in stock | $81.00 | $57.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF82544 |
Chemical Name: | JK184 |
CAS Number: | 315703-52-7 |
Molecular Formula: | C19H18N4OS |
Molecular Weight: | 350.4374 |
MDL Number: | MFCD01044465 |
SMILES: | CCOc1ccc(cc1)Nc1scc(n1)c1c(C)nc2n1cccc2 |
Complexity: | 432 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 5.1 |
Bioorganic & medicinal chemistry letters 20130801
Angewandte Chemie (International ed. in English) 20090101
Chembiochem : a European journal of chemical biology 20071105