AF56428
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $14.00 | $10.00 | - + | |
100mg | 95% | in stock | $18.00 | $13.00 | - + | |
500mg | 95% | in stock | $40.00 | $28.00 | - + | |
1g | 95% | in stock | $47.00 | $33.00 | - + | |
5g | 95% | in stock | $120.00 | $84.00 | - + | |
10g | 95% | in stock | $227.00 | $159.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF56428 |
Chemical Name: | Tetrahydroxyquinone |
CAS Number: | 319-89-1 |
Molecular Formula: | C6H4O6 |
Molecular Weight: | 172.0924 |
MDL Number: | MFCD00149070 |
SMILES: | OC1=C(O)C(=O)C(=C(C1=O)O)O |
Complexity: | 272 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
XLogP3: | -0.6 |
Bioorganic & medicinal chemistry letters 20101101
Journal of agricultural and food chemistry 20020410
Biochimica et biophysica acta 19951115