AI66168
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 65% | 2 weeks | $22.00 | $15.00 | - + | |
25g | 65% | 2 weeks | $23.00 | $16.00 | - + | |
100g | 65% | 2 weeks | $42.00 | $29.00 | - + | |
500g | 65% | 2 weeks | $123.00 | $86.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI66168 |
Chemical Name: | Pyridine, compd. with hydrofluoric acid |
CAS Number: | 32001-55-1 |
Molecular Formula: | C10H11NO2 |
Molecular Weight: | 177.1998 |
MDL Number: | MFCD00210092 |
SMILES: | OC(=O)[C@]1(N)C[C@@H]1c1ccccc1 |