AB53176
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $103.00 | $72.00 | - + | |
1g | 96% | in stock | $105.00 | $74.00 | - + | |
5g | 96% | in stock | $297.00 | $208.00 | - + | |
10g | 96% | in stock | $510.00 | $357.00 | - + | |
25g | 96% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53176 |
Chemical Name: | D-m-Tyrosine |
CAS Number: | 32140-49-1 |
Molecular Formula: | C9H11NO3 |
Molecular Weight: | 181.1885 |
MDL Number: | MFCD03788083 |
SMILES: | OC(=O)[C@@H](Cc1cccc(c1)O)N |
Complexity: | 184 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | -2.4 |
3-Hydroxy-D-phenylalanine, also known as DOPA, is a valuable compound utilized in chemical synthesis for its versatile applications. In the field of organic chemistry, 3-Hydroxy-D-phenylalanine serves as a key intermediate in the synthesis of various pharmaceuticals and bioactive molecules. Its hydroxyl group allows for selective functionalization, enabling the incorporation of diverse chemical moieties and structural modifications. Additionally, 3-Hydroxy-D-phenylalanine plays a crucial role in the synthesis of neurotransmitters such as dopamine and melanin, making it significant in the study of neurochemistry and pharmacology. Its involvement in peptide synthesis further underscores its importance as a building block for creating complex biomolecules with specific biological activities. Overall, 3-Hydroxy-D-phenylalanine is a fundamental component in chemical synthesis, facilitating the creation of novel compounds with wide-ranging applications in medicine, biology, and materials science.