AB60701
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $28.00 | $19.00 | - + | |
1g | 98% | in stock | $52.00 | $37.00 | - + | |
5g | 98% | in stock | $150.00 | $105.00 | - + | |
10g | 98% | in stock | $245.00 | $172.00 | - + | |
25g | 98% | in stock | $557.00 | $390.00 | - + | |
100g | 98% | in stock | $1,880.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60701 |
Chemical Name: | 2,6-Dimethylpyridine-4-boronic acid, pinacol ester |
CAS Number: | 325142-95-8 |
Molecular Formula: | C13H20BNO2 |
Molecular Weight: | 233.1144 |
MDL Number: | MFCD11617853 |
SMILES: | Cc1cc(cc(n1)C)B1OC(C(O1)(C)C)(C)C |
Complexity: | 267 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
Journal of medicinal chemistry 20120308