AB71339
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $34.00 | $24.00 | - + | |
10g | 95% | in stock | $65.00 | $45.00 | - + | |
25g | 95% | in stock | $125.00 | $88.00 | - + | |
100g | 95% | in stock | $369.00 | $259.00 | - + | |
500g | 95% | in stock | $1,132.00 | $793.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71339 |
Chemical Name: | Bis(vinylsulfonyl)methane |
CAS Number: | 3278-22-6 |
Molecular Formula: | C5H8O4S2 |
Molecular Weight: | 196.24462000000003 |
MDL Number: | MFCD03265421 |
SMILES: | C=CS(=O)(=O)CS(=O)(=O)C=C |
Complexity: | 299 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.1 |
Langmuir : the ACS journal of surfaces and colloids 20060926