AB65111
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $8.00 | $5.00 | - + | |
1g | 97% | in stock | $12.00 | $9.00 | - + | |
5g | 97% | in stock | $47.00 | $33.00 | - + | |
10g | 97% | in stock | $73.00 | $51.00 | - + | |
25g | 97% | in stock | $126.00 | $88.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB65111 |
Chemical Name: | 3-Hydroxy-5-(trifluoromethyl)benzoic acid |
CAS Number: | 328-69-8 |
Molecular Formula: | C8H5F3O3 |
Molecular Weight: | 206.1187 |
MDL Number: | MFCD07368783 |
SMILES: | Oc1cc(cc(c1)C(F)(F)F)C(=O)O |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2 |
3-Hydroxy-5-(trifluoromethyl)benzoic acid, also known as $name$, serves as a versatile building block in chemical synthesis. This compound plays a crucial role in various organic reactions and transformations due to its unique structure and reactivity. One key application of 3-Hydroxy-5-(trifluoromethyl)benzoic acid is its use as a starting material in the synthesis of pharmaceuticals and agrochemicals. By incorporating this compound into a synthesis pathway, chemists can introduce the trifluoromethyl group which imparts valuable properties such as increased chemical stability and improved biological activity to the final product. Additionally, the hydroxyl group in 3-Hydroxy-5-(trifluoromethyl)benzoic acid allows for further derivatization, enabling the synthesis of a wide range of functionalized organic molecules. In organic chemistry, this compound acts as a versatile intermediate, facilitating the creation of complex molecular structures with precision and efficiency.