AB44106
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $17.00 | $12.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $41.00 | $29.00 | - + | |
10g | 95% | in stock | $79.00 | $56.00 | - + | |
100g | 95% | in stock | $696.00 | $488.00 | - + | |
500g | 95% | in stock | $3,046.00 | $2,133.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44106 |
Chemical Name: | 3-Nitro-5-(trifluoromethyl)pyridin-2-ol |
CAS Number: | 33252-64-1 |
Molecular Formula: | C6H3F3N2O3 |
Molecular Weight: | 208.0948 |
MDL Number: | MFCD00153193 |
SMILES: | [O-][N+](=O)c1cc(c[nH]c1=O)C(F)(F)F |
Complexity: | 350 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 0.7 |
2-Hydroxy-3-nitro-5-(trifluoromethyl)pyridine is a versatile compound used in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the creation of various chemical compounds and pharmaceuticals due to its ability to undergo multiple transformations in organic reactions. Its trifluoromethyl group provides electron-withdrawing characteristics, making it a valuable moiety for enhancing the stability and reactivity of the molecules it is incorporated into. Additionally, the presence of the hydroxy and nitro groups offers opportunities for functional group interconversion, making this compound a key intermediate in the synthesis of more complex organic molecules. Its application in chemical synthesis extends to the development of agrochemicals, pharmaceuticals, and materials science, where its structural features can be tailored to achieve specific properties and functionalities required for various applications.