AJ12788
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 99% | in stock | $53.00 | $37.00 | - + | |
100g | 99% | in stock | $94.00 | $66.00 | - + | |
250g | 99% | in stock | $157.00 | $110.00 | - + | |
1kg | 99% | in stock | $389.00 | $273.00 | - + | |
5kg | 99% | in stock | $1,560.00 | $1,092.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AJ12788 |
Chemical Name: | 2,3-Pyridinedicarboxylicacid, labeled with tritium (9CI) |
CAS Number: | 339155-13-4 |
Molecular Formula: | C7H5NO4 |
Molecular Weight: | 167.1189 |
MDL Number: | MFCD00006295 |
SMILES: | C1=CC(=C(N=C1)C(=O)O)C(=O)O |