AF59337
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $8.00 | $6.00 | - + | |
250mg | 95% | in stock | $13.00 | $9.00 | - + | |
1g | 95% | in stock | $48.00 | $34.00 | - + | |
5g | 98% | in stock | $147.00 | $103.00 | - + | |
25g | 98% | in stock | $605.00 | $423.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF59337 |
Chemical Name: | Ethyl N-[(2-Boc-amino)ethyl]glycinate, HCl |
CAS Number: | 347890-34-0 |
Molecular Formula: | C11H23ClN2O4 |
Molecular Weight: | 282.7643 |
MDL Number: | MFCD01862956 |
SMILES: | CCOC(=O)CNCCNC(=O)OC(C)(C)C.Cl |
Complexity: | 248 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 9 |
The Journal of organic chemistry 20030221