AB51175
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $123.00 | $86.00 | - + | |
100mg | 95% | in stock | $220.00 | $154.00 | - + | |
250mg | 95% | in stock | $458.00 | $321.00 | - + | |
500mg | 95% | in stock | $733.00 | $513.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51175 |
Chemical Name: | 3-(4-hydroxyphenoxy)benzoic acid |
CAS Number: | 35065-12-4 |
Molecular Formula: | C13H10O4 |
Molecular Weight: | 230.2161 |
MDL Number: | MFCD00869792 |
SMILES: | Oc1ccc(cc1)Oc1cccc(c1)C(=O)O |
Complexity: | 258 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.6 |
Journal of agricultural and food chemistry 20090812