AD47141
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $213.00 | $149.00 | - + | |
1g | 97% | in stock | $479.00 | $335.00 | - + | |
5g | 97% | in stock | $1,603.00 | $1,122.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD47141 |
Chemical Name: | 4-(3,5-Difluorophenyl)benzoic acid |
CAS Number: | 350682-84-7 |
Molecular Formula: | C13H8F2O2 |
Molecular Weight: | 234.1982 |
MDL Number: | MFCD03839971 |
SMILES: | OC(=O)c1ccc(cc1)c1cc(F)cc(c1)F |
Complexity: | 265 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.3 |
The Biochemical journal 20071115
Journal of medicinal chemistry 20040115