AI48628
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $13.00 | $9.00 | - + | |
10g | 98% | in stock | $18.00 | $12.00 | - + | |
25g | 98% | in stock | $38.00 | $26.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI48628 |
Chemical Name: | (1R,2R)-(+)-1,2-Diphenylethylenediamine |
CAS Number: | 35132-20-8 |
Molecular Formula: | C14H16N2 |
Molecular Weight: | 212.2902 |
MDL Number: | MFCD00082769 |
SMILES: | N[C@@H]([C@@H](c1ccccc1)N)c1ccccc1 |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.4 |
Chemistry (Weinheim an der Bergstrasse, Germany) 20120220
Journal of separation science 20101001
Chirality 20100601
Inorganic chemistry 20100201
Bioorganic & medicinal chemistry 20090501
Chemical & pharmaceutical bulletin 20070901
Chirality 20070201
Chemical communications (Cambridge, England) 20060314
Magnetic resonance in chemistry : MRC 20060101
Chemical communications (Cambridge, England) 20050714
Organic & biomolecular chemistry 20050607
Antiviral research 20040801
Inorganic chemistry 20040726
The Journal of organic chemistry 20040625