AI48639
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $16.00 | $12.00 | - + | |
10g | 97% | in stock | $32.00 | $23.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI48639 |
Chemical Name: | Boc-Val-NH2 |
CAS Number: | 35150-08-4 |
Molecular Formula: | C10H20N2O3 |
Molecular Weight: | 216.2774 |
MDL Number: | MFCD00190841 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)N)C(C)C |
Complexity: | 244 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 0.8 |
The Journal of organic chemistry 20050902