AI48798
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $14.00 | $10.00 | - + | |
5g | 97% | in stock | $16.00 | $11.00 | - + | |
25g | 97% | in stock | $16.00 | $12.00 | - + | |
500g | 97% | in stock | $299.00 | $209.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI48798 |
Chemical Name: | Fmoc-Trp-OH |
CAS Number: | 35737-15-6 |
Molecular Formula: | C26H22N2O4 |
Molecular Weight: | 426.4639 |
MDL Number: | MFCD00037126 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1c[nH]c2c1cccc2)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 663 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.1 |
European journal of medicinal chemistry 20090501
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Journal of chromatography. A 20051202
Analytical chemistry 20050315
Analytical chemistry 20050101