AB57319
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
200mg | 98% | in stock | $72.00 | $50.00 | - + | |
1g | 98% | in stock | $237.00 | $166.00 | - + | |
5g | 98% | in stock | $492.00 | $344.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57319 |
Chemical Name: | 1,3-Dicyclohexylbarbituric acid |
CAS Number: | 35824-91-0 |
Molecular Formula: | C16H24N2O3 |
Molecular Weight: | 292.37336000000005 |
MDL Number: | MFCD01216967 |
SMILES: | O=C1N(C2CCCCC2)C(=O)CC(=O)N1C1CCCCC1 |
Complexity: | 399 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.8 |
Journal of medicinal chemistry 20110414