AF67144
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $74.00 | $52.00 | - + | |
5g | 98% | in stock | $203.00 | $142.00 | - + | |
10g | 98% | in stock | $315.00 | $221.00 | - + | |
25g | 98% | in stock | $605.00 | $423.00 | - + | |
100g | 98% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF67144 |
Chemical Name: | 4-Hydroxy-8-methylquinoline-3-carboxylic acid |
CAS Number: | 35966-17-7 |
Molecular Formula: | C11H9NO3 |
Molecular Weight: | 203.1941 |
MDL Number: | MFCD01909986 |
SMILES: | OC(=O)c1c[nH]c2c(c1=O)cccc2C |
NSC Number: | 199379 |
Complexity: | 335 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20061102