AB70214
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $39.00 | $28.00 | - + | |
250mg | 95% | in stock | $72.00 | $50.00 | - + | |
1g | 95% | in stock | $97.00 | $68.00 | - + | |
5g | 95% | in stock | $297.00 | $208.00 | - + | |
10g | 95% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70214 |
Chemical Name: | 8-Bromo-4-hydroxyquinoline-3-carboxylic acid |
CAS Number: | 35973-17-2 |
Molecular Formula: | C10H6BrNO3 |
Molecular Weight: | 268.0635 |
MDL Number: | MFCD02179785 |
SMILES: | OC(=O)c1cnc2c(c1O)cccc2Br |
Complexity: | 340 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.5 |
Journal of medicinal chemistry 20061102