AB67657
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $62.00 | $44.00 | - + | |
25g | 96% | in stock | $1,319.00 | $923.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67657 |
Chemical Name: | 4-Hydroxy-6-methylquinoline-3-carboxylic acid |
CAS Number: | 35973-18-3 |
Molecular Formula: | C11H9NO3 |
Molecular Weight: | 203.1941 |
MDL Number: | MFCD00454147 |
SMILES: | Cc1ccc2c(c1)c(O)c(cn2)C(=O)O |
NSC Number: | 77103 |
Complexity: | 335 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20061102