AI48868
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $251.00 | $176.00 | - + | |
5g | 95% | in stock | $713.00 | $499.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI48868 |
Chemical Name: | 5H-1,2,4-Triazino[5,6-b]indol-3-amine |
CAS Number: | 36047-75-3 |
Molecular Formula: | C9H7N5 |
Molecular Weight: | 185.1854 |
MDL Number: | MFCD00463389 |
SMILES: | Nc1nnc2c(n1)[nH]c1c2cccc1 |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 0.7 |
Journal of medicinal chemistry 19720301