AB57492
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $15.00 | $10.00 | - + | |
5g | 97% | in stock | $15.00 | $11.00 | - + | |
25g | 97% | in stock | $15.00 | $11.00 | - + | |
100g | 97% | in stock | $29.00 | $21.00 | - + | |
500g | 97% | in stock | $105.00 | $74.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57492 |
Chemical Name: | 2,5-Difluoronitrobenzene |
CAS Number: | 364-74-9 |
Molecular Formula: | C6H3F2NO2 |
Molecular Weight: | 159.09032639999998 |
MDL Number: | MFCD00007054 |
SMILES: | Fc1ccc(c(c1)[N+](=O)[O-])F |
NSC Number: | 528657 |
Complexity: | 159 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 1.8 |
The journal of physical chemistry. B 20101014