AF60998
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $21.00 | $15.00 | - + | |
1g | 98% | in stock | $54.00 | $38.00 | - + | |
25g | 98% | in stock | $1,100.00 | $770.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF60998 |
Chemical Name: | 4-(2-Fluorophenyl)benzoic acid |
CAS Number: | 365-12-8 |
Molecular Formula: | C13H9FO2 |
Molecular Weight: | 216.2078 |
MDL Number: | MFCD00278732 |
SMILES: | Fc1ccccc1c1ccc(cc1)C(=O)O |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.5 |
Journal of medicinal chemistry 20040115