AB79862
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $30.00 | $21.00 | - + | |
5g | 95% | in stock | $54.00 | $38.00 | - + | |
10g | 95% | in stock | $73.00 | $51.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79862 |
Chemical Name: | trans-4-Aminocyclohexanecarboxylic acid |
CAS Number: | 3685-25-4 |
Molecular Formula: | C7H13NO2 |
Molecular Weight: | 143.1836 |
MDL Number: | MFCD00209953 |
SMILES: | N[C@@H]1CC[C@H](CC1)C(=O)O |
Complexity: | 128 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -2.2 |
Biochimica et biophysica acta 20110101
Analytical and bioanalytical chemistry 20101001
Neurochemical research 20091001
PloS one 20080101
Protein and peptide letters 20070101
Acta crystallographica. Section C, Crystal structure communications 20041001
Bioorganic & medicinal chemistry 20020901