AB49247
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $31.00 | $22.00 | - + | |
5g | 95% | in stock | $127.00 | $89.00 | - + | |
25g | 95% | in stock | $512.00 | $358.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49247 |
Chemical Name: | Bis(cyclopentadienyl)zirconiumchloridehydride |
CAS Number: | 37342-97-5 |
Molecular Formula: | C10H11ClZr |
Molecular Weight: | 257.8713400000001 |
MDL Number: | MFCD02089401 |
SMILES: | [Cl-][Zr+4]12345678([CH-]9[CH]7=[CH]4[CH]1=[CH]89)[CH-]1[CH]5=[CH]3[CH]2=[CH]61 |
Complexity: | 163 |
Covalently-Bonded Unit Count: | 5 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
$name$ is a highly versatile and essential compound in chemical synthesis. Its unique properties make it a valuable tool in various chemical reactions, particularly in organic synthesis and catalysis. When used in chemical transformations, $name$ acts as a powerful catalyst, facilitating key bond-forming processes with high efficiency and selectivity. Its ability to participate in both stoichiometric and catalytic reactions makes it a preferred choice for generating complex organic molecules. Additionally, $name$ serves as a reliable reducing agent, enabling the conversion of functional groups and the modulation of reactivity in a controlled manner. By harnessing the reactivity of $name$, chemists can access new pathways for the preparation of pharmaceuticals, agrochemicals, and advanced materials.