AB77712
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $24.00 | $17.00 | - + | |
5g | 95% | in stock | $60.00 | $42.00 | - + | |
10g | 95% | in stock | $93.00 | $65.00 | - + | |
25g | 95% | in stock | $200.00 | $140.00 | - + | |
100g | 95% | in stock | $619.00 | $433.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77712 |
Chemical Name: | Nonafluorobutanesulfonic acid |
CAS Number: | 375-73-5 |
Molecular Formula: | C4HF9O3S |
Molecular Weight: | 300.0995687999999 |
MDL Number: | MFCD01320794 |
SMILES: | FC(C(C(S(=O)(=O)O)(F)F)(F)F)(C(F)(F)F)F |
Complexity: | 387 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 12 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.3 |
Nonafluorobutane-1-sulfonic acid, also known as NFSI, is a powerful fluorinating agent widely used in organic chemistry for various transformations. Its unique chemical properties make it a valuable reagent in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.NFSI is particularly valuable in introducing fluorine atoms into organic molecules, a process known as fluorination. This fluorinating ability can lead to significant changes in a compound's properties, such as improved stability, altered reactivity, and enhanced bioavailability. In organic synthesis, the introduction of fluorine atoms often enhances the overall efficacy of the final product.Additionally, NFSI is utilized in the preparation of complex fluorine-containing building blocks that are challenging to synthesize using other methods. These building blocks serve as key intermediates in the production of various functional materials and specialty chemicals.Moreover, NFSI can participate in various reactions, such as halogen exchange and electrophilic fluorination, making it a versatile tool in the hands of synthetic chemists. Its capacity to selectively fluorinate specific positions in complex molecules has made it a popular choice in the field of chemical synthesis.In summary, Nonafluorobutane-1-sulfonic acid plays a crucial role in modern chemical synthesis, offering synthetic chemists a powerful and selective fluorinating agent to facilitate the creation of novel compounds with enhanced properties and functionalities.