AB44377
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $5.00 | - + | |
10g | 98% | in stock | $8.00 | $6.00 | - + | |
25g | 98% | in stock | $19.00 | $14.00 | - + | |
100g | 98% | in stock | $69.00 | $48.00 | - + | |
500g | 98% | in stock | $264.00 | $185.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44377 |
Chemical Name: | 3,6-Di-tert-butylcarbazole |
CAS Number: | 37500-95-1 |
Molecular Formula: | C20H25N |
Molecular Weight: | 279.4192 |
MDL Number: | MFCD03788903 |
SMILES: | CC(c1ccc2c(c1)c1cc(ccc1[nH]2)C(C)(C)C)(C)C |
Complexity: | 336 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 6.7 |
Inorganic chemistry 20120116
Chemistry (Weinheim an der Bergstrasse, Germany) 20110502
The journal of physical chemistry. A 20100408
Physical chemistry chemical physics : PCCP 20100314
Journal of the American Chemical Society 20030507