AB46114
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $19.00 | $13.00 | - + | |
25g | 97% | in stock | $20.00 | $14.00 | - + | |
100g | 97% | in stock | $57.00 | $40.00 | - + | |
250g | 97% | in stock | $110.00 | $77.00 | - + | |
500g | 97% | in stock | $199.00 | $139.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46114 |
Chemical Name: | Ethyl indole-2-carboxylate |
CAS Number: | 3770-50-1 |
Molecular Formula: | C11H11NO2 |
Molecular Weight: | 189.2105 |
MDL Number: | MFCD00005609 |
SMILES: | CCOC(=O)c1cc2c([nH]1)cccc2 |
NSC Number: | 10076 |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.2 |
Marine drugs 20100101
Molecules (Basel, Switzerland) 20051231
Journal of medicinal chemistry 20030605