AB60189
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $137.00 | $96.00 | - + | |
1g | 98% | in stock | $330.00 | $231.00 | - + | |
5g | 98% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60189 |
Chemical Name: | 2',4'-Dichlorobiphenyl-3-carboxylic acid |
CAS Number: | 380228-58-0 |
Molecular Formula: | C13H8Cl2O2 |
Molecular Weight: | 267.1074 |
MDL Number: | MFCD11574827 |
SMILES: | Clc1ccc(c(c1)Cl)c1cccc(c1)C(=O)O |
Complexity: | 283 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.8 |
Journal of medicinal chemistry 20050407