AF60860
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98%(HPLC) | in stock | $42.00 | $30.00 | - + | |
10mg | ≥98% | in stock | $80.00 | $56.00 | - + | |
25mg | 98%(HPLC) | in stock | $103.00 | $73.00 | - + | |
100mg | 98%(HPLC) | in stock | $226.00 | $159.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF60860 |
Chemical Name: | Tenovin-1 |
CAS Number: | 380315-80-0 |
Molecular Formula: | C20H23N3O2S |
Molecular Weight: | 369.4805 |
MDL Number: | MFCD02914760 |
SMILES: | CC(=O)Nc1ccc(cc1)NC(=S)NC(=O)c1ccc(cc1)C(C)(C)C |
Complexity: | 514 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.4 |
Archives of toxicology 20171201